C21H21F3N4O2 — CID 175864654
(R)-(1,3-dimethylazetidin-3-yl)-[5-(1,2,4-oxadiazol-3-yl)-3-pyridinyl]-[4-(2,2,2-trifluoroethyl)phenyl]methanol (PubChem CID 175864654) has the molecular formula C21H21F3N4O2 and a molecular weight of 418.42 g/mol. Its IUPAC name is (R)-(1,3-dimethylazetidin-3-yl)-[5-(1,2,4-oxadiazol-3-yl)-3-pyridinyl]-[4-(2,2,2-trifluoroethyl)phenyl]methanol.
| Compound Name | (R)-(1,3-dimethylazetidin-3-yl)-[5-(1,2,4-oxadiazol-3-yl)-3-pyridinyl]-[4-(2,2,2-trifluoroethyl)phenyl]methanol |
|---|---|
| PubChem CID | 175864654 |
| Molecular Formula | C21H21F3N4O2 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (R)-(1,3-dimethylazetidin-3-yl)-[5-(1,2,4-oxadiazol-3-yl)-3-pyridinyl]-[4-(2,2,2-trifluoroethyl)phenyl]methanol |
| SMILES | CN1CC(C)([C@](O)(c2ccc(CC(F)(F)F)cc2)c2cncc(-c3ncon3)c2)C1 |
| InChI | InChI=1S/C21H21F3N4O2/c1-19(11-28(2)12-19)21(29,16-5-3-14(4-6-16)8-20(22,23)24)17-7-15(9-25-10-17)18-26-13-30-27-18/h3-7,9-10,13,29H,8,11-12H2,1-2H3/t21-/m0/s1 |
| InChIKey | DDAXXPVSEGOVHY-NRFANRHFSA-N |
| XLogP | 3.42 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |