About 1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+)
1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+) (PubChem CID 175865401) has the molecular formula C25H24IrN2O2+3
and a molecular weight of 576.70 g/mol. Its IUPAC name is 1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+).
Molecular Properties
| Compound Name | 1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+) |
| PubChem CID | 175865401 |
| Molecular Formula | C25H24IrN2O2+3 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | 1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+) |
| SMILES | CC(=O)CC(=O)CC1(c2ccccc2)Nc2ccccc2N1Cc1ccccc1.[Ir+3] |
| InChI | InChI=1S/C25H24N2O2.Ir/c1-19(28)16-22(29)17-25(21-12-6-3-7-13-21)26-23-14-8-9-15-24(23)27(25)18-20-10-4-2-5-11-20;/h2-15,26H,16-18H2,1H3;/q;+3 |
| InChIKey | RCPWTBRNYRCYDY-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+)?
The IUPAC name of 1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+) (CID 175865401) is 1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+).
What is the SMILES notation for 1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+)?
The canonical SMILES for 1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+) is CC(=O)CC(=O)CC1(c2ccccc2)Nc2ccccc2N1Cc1ccccc1.[Ir+3].
What is the InChIKey of 1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+)?
The InChIKey is RCPWTBRNYRCYDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O2.Ir/c1-19(28)16-22(29)17-25(21-12-6-3-7-13-21)26-23-14-8-9-15-24(23)27(25)18-20-10-4-2-5-11-20;/h2-15,26H,16-18H2,1H3;/q;+3.
What are the key properties of 1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+)?
1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+) has a molecular weight of 576.70 g/mol, XLogP of 4.91, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-benzyl-2-phenyl-1H-benzimidazol-2-yl)pentane-2,4-dione;iridium(3+) is sourced from PubChem (CID 175865401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).