About N-fluoro-2,1,3-benzothiadiazol-5-amine
N-fluoro-2,1,3-benzothiadiazol-5-amine (PubChem CID 175865678) has the molecular formula C6H4FN3S
and a molecular weight of 169.18 g/mol. Its IUPAC name is N-fluoro-2,1,3-benzothiadiazol-5-amine.
Molecular Properties
| Compound Name | N-fluoro-2,1,3-benzothiadiazol-5-amine |
| PubChem CID | 175865678 |
| Molecular Formula | C6H4FN3S |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.01 |
| IUPAC Name | N-fluoro-2,1,3-benzothiadiazol-5-amine |
| SMILES | FNc1ccc2nsnc2c1 |
| InChI | InChI=1S/C6H4FN3S/c7-8-4-1-2-5-6(3-4)10-11-9-5/h1-3,8H |
| InChIKey | XBDPNJZTYARPRM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-fluoro-2,1,3-benzothiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-fluoro-2,1,3-benzothiadiazol-5-amine?
The IUPAC name of N-fluoro-2,1,3-benzothiadiazol-5-amine (CID 175865678) is N-fluoro-2,1,3-benzothiadiazol-5-amine.
What is the SMILES notation for N-fluoro-2,1,3-benzothiadiazol-5-amine?
The canonical SMILES for N-fluoro-2,1,3-benzothiadiazol-5-amine is FNc1ccc2nsnc2c1.
What is the InChIKey of N-fluoro-2,1,3-benzothiadiazol-5-amine?
The InChIKey is XBDPNJZTYARPRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4FN3S/c7-8-4-1-2-5-6(3-4)10-11-9-5/h1-3,8H.
What are the key properties of N-fluoro-2,1,3-benzothiadiazol-5-amine?
N-fluoro-2,1,3-benzothiadiazol-5-amine has a molecular weight of 169.18 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-fluoro-2,1,3-benzothiadiazol-5-amine is sourced from PubChem (CID 175865678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).