C26H33F2NO7S — CID 175867637
17-[(2R)-2-acetamido-3-sulfanylpropanoyl]oxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 175867637) has the molecular formula C26H33F2NO7S and a molecular weight of 541.61 g/mol. Its IUPAC name is 17-[(2R)-2-acetamido-3-sulfanylpropanoyl]oxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | 17-[(2R)-2-acetamido-3-sulfanylpropanoyl]oxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 175867637 |
| Molecular Formula | C26H33F2NO7S |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 17-[(2R)-2-acetamido-3-sulfanylpropanoyl]oxy-6,9-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | CC(=O)N[C@@H](CS)C(=O)OC1(C(=O)O)C(C)CC2C3CC(F)C4=CC(=O)C=CC4(C)C3(F)C(O)CC21C |
| InChI | InChI=1S/C26H33F2NO7S/c1-12-7-15-16-9-18(27)17-8-14(31)5-6-23(17,3)25(16,28)20(32)10-24(15,4)26(12,22(34)35)36-21(33)19(11-37)29-13(2)30/h5-6,8,12,15-16,18-20,32,37H,7,9-11H2,1-4H3,(H,29,30)(H,34,35)/t12?,15?,16?,18?,19-,20?,23?,24?,25?,26?/m0/s1 |
| InChIKey | QWAJLXCFWIZBCV-KRBARTTOSA-N |
| XLogP | 2.35 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|