About 6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine
6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine (PubChem CID 175867639) has the molecular formula C14H16FN3O3S
and a molecular weight of 325.37 g/mol. Its IUPAC name is 6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine.
Molecular Properties
| Compound Name | 6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine |
| PubChem CID | 175867639 |
| Molecular Formula | C14H16FN3O3S |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine |
| SMILES | COCOc1cc(C)cc(F)c1-c1nnc(S(C)=O)nc1C |
| InChI | InChI=1S/C14H16FN3O3S/c1-8-5-10(15)12(11(6-8)21-7-20-3)13-9(2)16-14(18-17-13)22(4)19/h5-6H,7H2,1-4H3 |
| InChIKey | YFICIRZMZHTGNG-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine?
The IUPAC name of 6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine (CID 175867639) is 6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine.
What is the SMILES notation for 6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine?
The canonical SMILES for 6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine is COCOc1cc(C)cc(F)c1-c1nnc(S(C)=O)nc1C.
What is the InChIKey of 6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine?
The InChIKey is YFICIRZMZHTGNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16FN3O3S/c1-8-5-10(15)12(11(6-8)21-7-20-3)13-9(2)16-14(18-17-13)22(4)19/h5-6H,7H2,1-4H3.
What are the key properties of 6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine?
6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine has a molecular weight of 325.37 g/mol, XLogP of 2.01, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-fluoro-6-(methoxymethoxy)-4-methylphenyl]-5-methyl-3-methylsulfinyl-1,2,4-triazine is sourced from PubChem (CID 175867639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).