About (2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde
(2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde (PubChem CID 175868877) has the molecular formula C12H17F3N2O4
and a molecular weight of 310.27 g/mol. Its IUPAC name is (2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde.
Molecular Properties
| Compound Name | (2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde |
| PubChem CID | 175868877 |
| Molecular Formula | C12H17F3N2O4 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde |
| SMILES | C[C@@H](C(=O)O)N(C)C(=O)C#CCN(C)C.O=CC(F)(F)F |
| InChI | InChI=1S/C10H16N2O3.C2HF3O/c1-8(10(14)15)12(4)9(13)6-5-7-11(2)3;3-2(4,5)1-6/h8H,7H2,1-4H3,(H,14,15);1H/t8-;/m0./s1 |
| InChIKey | OGLJNRYSBQGUDO-QRPNPIFTSA-N |
| XLogP | 0.23 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde?
The IUPAC name of (2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde (CID 175868877) is (2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde.
What is the SMILES notation for (2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde?
The canonical SMILES for (2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde is C[C@@H](C(=O)O)N(C)C(=O)C#CCN(C)C.O=CC(F)(F)F.
What is the InChIKey of (2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde?
The InChIKey is OGLJNRYSBQGUDO-QRPNPIFTSA-N. The full InChI is InChI=1S/C10H16N2O3.C2HF3O/c1-8(10(14)15)12(4)9(13)6-5-7-11(2)3;3-2(4,5)1-6/h8H,7H2,1-4H3,(H,14,15);1H/t8-;/m0./s1.
What are the key properties of (2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde?
(2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde has a molecular weight of 310.27 g/mol, XLogP of 0.23, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[4-(dimethylamino)but-2-ynoyl-methylamino]propanoic acid;2,2,2-trifluoroacetaldehyde is sourced from PubChem (CID 175868877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).