C26H35FN8O2S — CID 175869098
N-[4-[(3S,4R)-3-fluoro-4-methylpiperidin-1-yl]-1,3,5-triazin-2-yl]-8-[(2R,3S)-2-methyl-3-(methylsulfonylmethyl)azetidin-1-yl]-5-propan-2-yl-2,6-naphthyridin-3-amine (PubChem CID 175869098) has the molecular formula C26H35FN8O2S and a molecular weight of 542.69 g/mol. Its IUPAC name is N-[4-[(3S,4R)-3-fluoro-4-methylpiperidin-1-yl]-1,3,5-triazin-2-yl]-8-[(2R,3S)-2-methyl-3-(methylsulfonylmethyl)azetidin-1-yl]-5-propan-2-yl-2,6-naphthyridin-3-amine.
| Compound Name | N-[4-[(3S,4R)-3-fluoro-4-methylpiperidin-1-yl]-1,3,5-triazin-2-yl]-8-[(2R,3S)-2-methyl-3-(methylsulfonylmethyl)azetidin-1-yl]-5-propan-2-yl-2,6-naphthyridin-3-amine |
|---|---|
| PubChem CID | 175869098 |
| Molecular Formula | C26H35FN8O2S |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | N-[4-[(3S,4R)-3-fluoro-4-methylpiperidin-1-yl]-1,3,5-triazin-2-yl]-8-[(2R,3S)-2-methyl-3-(methylsulfonylmethyl)azetidin-1-yl]-5-propan-2-yl-2,6-naphthyridin-3-amine |
| SMILES | CC(C)c1ncc(N2C[C@H](CS(C)(=O)=O)[C@H]2C)c2cnc(Nc3ncnc(N4CC[C@@H](C)[C@H](F)C4)n3)cc12 |
| InChI | InChI=1S/C26H35FN8O2S/c1-15(2)24-19-8-23(32-25-30-14-31-26(33-25)34-7-6-16(3)21(27)12-34)28-9-20(19)22(10-29-24)35-11-18(17(35)4)13-38(5,36)37/h8-10,14-18,21H,6-7,11-13H2,1-5H3,(H,28,30,31,32,33)/t16-,17-,18-,21-/m1/s1 |
| InChIKey | CMJIXOOGWQSRCQ-NEYJZJCJSA-N |
| XLogP | 3.74 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |