About 1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride
1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride (PubChem CID 175869105) has the molecular formula C12H17ClN2O
and a molecular weight of 240.73 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride |
| PubChem CID | 175869105 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride |
| SMILES | Cl.Nc1cccc2c1CNC2C1CCOC1 |
| InChI | InChI=1S/C12H16N2O.ClH/c13-11-3-1-2-9-10(11)6-14-12(9)8-4-5-15-7-8;/h1-3,8,12,14H,4-7,13H2;1H |
| InChIKey | YATLWGNVEVYEGC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride?
The IUPAC name of 1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride (CID 175869105) is 1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride.
What is the SMILES notation for 1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride?
The canonical SMILES for 1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride is Cl.Nc1cccc2c1CNC2C1CCOC1.
What is the InChIKey of 1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride?
The InChIKey is YATLWGNVEVYEGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O.ClH/c13-11-3-1-2-9-10(11)6-14-12(9)8-4-5-15-7-8;/h1-3,8,12,14H,4-7,13H2;1H.
What are the key properties of 1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride?
1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride has a molecular weight of 240.73 g/mol, XLogP of 1.87, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-3-yl)-2,3-dihydro-1H-isoindol-4-amine;hydrochloride is sourced from PubChem (CID 175869105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).