About 2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine
2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 175869515) has the molecular formula C17H13N5O
and a molecular weight of 303.33 g/mol. Its IUPAC name is 2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| PubChem CID | 175869515 |
| Molecular Formula | C17H13N5O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | C=Cc1ncc(-c2ccc(-c3nc(N)c4cc[nH]c4n3)cc2)o1 |
| InChI | InChI=1S/C17H13N5O/c1-2-14-20-9-13(23-14)10-3-5-11(6-4-10)16-21-15(18)12-7-8-19-17(12)22-16/h2-9H,1H2,(H3,18,19,21,22) |
| InChIKey | MDGJMKJCQPOPMN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The IUPAC name of 2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CID 175869515) is 2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine is C=Cc1ncc(-c2ccc(-c3nc(N)c4cc[nH]c4n3)cc2)o1.
What is the InChIKey of 2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
The InChIKey is MDGJMKJCQPOPMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N5O/c1-2-14-20-9-13(23-14)10-3-5-11(6-4-10)16-21-15(18)12-7-8-19-17(12)22-16/h2-9H,1H2,(H3,18,19,21,22).
What are the key properties of 2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine?
2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine has a molecular weight of 303.33 g/mol, XLogP of 3.51, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-ethenyl-1,3-oxazol-5-yl)phenyl]-7H-pyrrolo[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 175869515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).