About 1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate
1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate (PubChem CID 175869755) has the molecular formula C18H14BrFN2O3
and a molecular weight of 405.22 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate.
Molecular Properties
| Compound Name | 1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate |
| PubChem CID | 175869755 |
| Molecular Formula | C18H14BrFN2O3 |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate |
| SMILES | CC(Cc1ccc(F)cc1Br)OC(=O)c1cc2cccnc2[nH]c1=O |
| InChI | InChI=1S/C18H14BrFN2O3/c1-10(7-11-4-5-13(20)9-15(11)19)25-18(24)14-8-12-3-2-6-21-16(12)22-17(14)23/h2-6,8-10H,7H2,1H3,(H,21,22,23) |
| InChIKey | BZWWABGYOURYBE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate?
The IUPAC name of 1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate (CID 175869755) is 1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate.
What is the SMILES notation for 1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate?
The canonical SMILES for 1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate is CC(Cc1ccc(F)cc1Br)OC(=O)c1cc2cccnc2[nH]c1=O.
What is the InChIKey of 1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate?
The InChIKey is BZWWABGYOURYBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrFN2O3/c1-10(7-11-4-5-13(20)9-15(11)19)25-18(24)14-8-12-3-2-6-21-16(12)22-17(14)23/h2-6,8-10H,7H2,1H3,(H,21,22,23).
What are the key properties of 1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate?
1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate has a molecular weight of 405.22 g/mol, XLogP of 3.61, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromo-4-fluorophenyl)propan-2-yl 2-oxo-1H-1,8-naphthyridine-3-carboxylate is sourced from PubChem (CID 175869755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).