About N,N-dimethylprop-2-enamide
N,N-dimethylprop-2-enamide (PubChem CID 17587) has the molecular formula C5H9NO
and a molecular weight of 99.13 g/mol. Its IUPAC name is N,N-dimethylprop-2-enamide.
Molecular Properties
| Compound Name | N,N-dimethylprop-2-enamide |
| PubChem CID | 17587 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | N,N-dimethylprop-2-enamide |
| SMILES | C=CC(=O)N(C)C |
| InChI | InChI=1S/C5H9NO/c1-4-5(7)6(2)3/h4H,1H2,2-3H3 |
| InChIKey | YLGYACDQVQQZSW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylprop-2-enamide?
The IUPAC name of N,N-dimethylprop-2-enamide (CID 17587) is N,N-dimethylprop-2-enamide.
What is the SMILES notation for N,N-dimethylprop-2-enamide?
The canonical SMILES for N,N-dimethylprop-2-enamide is C=CC(=O)N(C)C.
What is the InChIKey of N,N-dimethylprop-2-enamide?
The InChIKey is YLGYACDQVQQZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO/c1-4-5(7)6(2)3/h4H,1H2,2-3H3.
What are the key properties of N,N-dimethylprop-2-enamide?
N,N-dimethylprop-2-enamide has a molecular weight of 99.13 g/mol, XLogP of 0.26, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylprop-2-enamide is sourced from PubChem (CID 17587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).