C21H40F3N3O3 — CID 175870134
N-hexyl-1-octylpiperazine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 175870134) has the molecular formula C21H40F3N3O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-hexyl-1-octylpiperazine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-hexyl-1-octylpiperazine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175870134 |
| Molecular Formula | C21H40F3N3O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | N-hexyl-1-octylpiperazine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCCCN1CCNCC1C(=O)NCCCCCC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H39N3O.C2HF3O2/c1-3-5-7-9-10-12-15-22-16-14-20-17-18(22)19(23)21-13-11-8-6-4-2;3-2(4,5)1(6)7/h18,20H,3-17H2,1-2H3,(H,21,23);(H,6,7) |
| InChIKey | GDTWRODQSOYDKU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|