C9H10F2N2 — CID 175870832
6,8-difluoro-1,2,3,4-tetrahydroisoquinolin-4-amine (PubChem CID 175870832) has the molecular formula C9H10F2N2 and a molecular weight of 184.19 g/mol. Its IUPAC name is 6,8-difluoro-1,2,3,4-tetrahydroisoquinolin-4-amine.
| Compound Name | 6,8-difluoro-1,2,3,4-tetrahydroisoquinolin-4-amine |
|---|---|
| PubChem CID | 175870832 |
| Molecular Formula | C9H10F2N2 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 6,8-difluoro-1,2,3,4-tetrahydroisoquinolin-4-amine |
| SMILES | NC1CNCc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C9H10F2N2/c10-5-1-6-7(8(11)2-5)3-13-4-9(6)12/h1-2,9,13H,3-4,12H2 |
| InChIKey | BVTQCXJVRAOUAM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |