About 1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-7-ol
1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-7-ol (PubChem CID 175870854) has the molecular formula C7H11N3O
and a molecular weight of 153.19 g/mol. Its IUPAC name is 1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-7-ol.
Analyze 1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-7-ol?
The IUPAC name of 1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-7-ol (CID 175870854) is 1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-7-ol.
What is the SMILES notation for 1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-7-ol?
The canonical SMILES for 1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-7-ol is Cn1ncc2c1C(O)CNC2.
What is the InChIKey of 1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-7-ol?
The InChIKey is KFVNRDNAVXJYIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O/c1-10-7-5(3-9-10)2-8-4-6(7)11/h3,6,8,11H,2,4H2,1H3.
What are the key properties of 1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-7-ol?
1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-7-ol has a molecular weight of 153.19 g/mol, XLogP of -0.44, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4,5,6,7-tetrahydropyrazolo[4,5-c]pyridin-7-ol is sourced from PubChem (CID 175870854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).