About (2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate
(2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate (PubChem CID 175870915) has the molecular formula C12H11F3NO3-
and a molecular weight of 274.22 g/mol. Its IUPAC name is (2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate.
Molecular Properties
| Compound Name | (2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate |
| PubChem CID | 175870915 |
| Molecular Formula | C12H11F3NO3- |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | (2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate |
| SMILES | O=C(Oc1c(F)cc(F)cc1F)C1CCN([O-])CC1 |
| InChI | InChI=1S/C12H11F3NO3/c13-8-5-9(14)11(10(15)6-8)19-12(17)7-1-3-16(18)4-2-7/h5-7H,1-4H2/q-1 |
| InChIKey | LNWAKCXLISUNOO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate?
The IUPAC name of (2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate (CID 175870915) is (2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate.
What is the SMILES notation for (2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate?
The canonical SMILES for (2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate is O=C(Oc1c(F)cc(F)cc1F)C1CCN([O-])CC1.
What is the InChIKey of (2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate?
The InChIKey is LNWAKCXLISUNOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3NO3/c13-8-5-9(14)11(10(15)6-8)19-12(17)7-1-3-16(18)4-2-7/h5-7H,1-4H2/q-1.
What are the key properties of (2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate?
(2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate has a molecular weight of 274.22 g/mol, XLogP of 2.22, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4,6-trifluorophenyl) 1-oxidopiperidine-4-carboxylate is sourced from PubChem (CID 175870915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).