C24H24N2O3S — CID 175870936
(3R)-8-cyclopropyl-N-ethoxy-7-(naphthalen-1-ylmethyl)-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxamide (PubChem CID 175870936) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is (3R)-8-cyclopropyl-N-ethoxy-7-(naphthalen-1-ylmethyl)-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxamide.
| Compound Name | (3R)-8-cyclopropyl-N-ethoxy-7-(naphthalen-1-ylmethyl)-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175870936 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (3R)-8-cyclopropyl-N-ethoxy-7-(naphthalen-1-ylmethyl)-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxamide |
| SMILES | CCONC(=O)[C@@H]1CSc2c(C3CC3)c(Cc3cccc4ccccc34)cc(=O)n21 |
| InChI | InChI=1S/C24H24N2O3S/c1-2-29-25-23(28)20-14-30-24-22(16-10-11-16)18(13-21(27)26(20)24)12-17-8-5-7-15-6-3-4-9-19(15)17/h3-9,13,16,20H,2,10-12,14H2,1H3,(H,25,28)/t20-/m0/s1 |
| InChIKey | GXFAREBPMKAAOZ-FQEVSTJZSA-N |
| XLogP | 4.18 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|