About 6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine
6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine (PubChem CID 175870951) has the molecular formula C9H9FN4
and a molecular weight of 192.20 g/mol. Its IUPAC name is 6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine |
| PubChem CID | 175870951 |
| Molecular Formula | C9H9FN4 |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine |
| SMILES | C=CCc1c(N)nn2cc(F)cnc12 |
| InChI | InChI=1S/C9H9FN4/c1-2-3-7-8(11)13-14-5-6(10)4-12-9(7)14/h2,4-5H,1,3H2,(H2,11,13) |
| InChIKey | RVHAYKHOOXNHNH-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine?
The IUPAC name of 6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine (CID 175870951) is 6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine.
What is the SMILES notation for 6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine?
The canonical SMILES for 6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine is C=CCc1c(N)nn2cc(F)cnc12.
What is the InChIKey of 6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine?
The InChIKey is RVHAYKHOOXNHNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FN4/c1-2-3-7-8(11)13-14-5-6(10)4-12-9(7)14/h2,4-5H,1,3H2,(H2,11,13).
What are the key properties of 6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine?
6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine has a molecular weight of 192.20 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-prop-2-enylpyrazolo[1,5-a]pyrimidin-2-amine is sourced from PubChem (CID 175870951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).