C17H13N5O4S3 — CID 175872110
4-[5-(4-amino-2-methylphenyl)sulfonyl-1,3,4-thiadiazol-2-yl]-3-thiophen-3-yl-1,2-oxazole-5-carboxamide (PubChem CID 175872110) has the molecular formula C17H13N5O4S3 and a molecular weight of 447.52 g/mol. Its IUPAC name is 4-[5-(4-amino-2-methylphenyl)sulfonyl-1,3,4-thiadiazol-2-yl]-3-thiophen-3-yl-1,2-oxazole-5-carboxamide.
| Compound Name | 4-[5-(4-amino-2-methylphenyl)sulfonyl-1,3,4-thiadiazol-2-yl]-3-thiophen-3-yl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 175872110 |
| Molecular Formula | C17H13N5O4S3 |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | 4-[5-(4-amino-2-methylphenyl)sulfonyl-1,3,4-thiadiazol-2-yl]-3-thiophen-3-yl-1,2-oxazole-5-carboxamide |
| SMILES | Cc1cc(N)ccc1S(=O)(=O)c1nnc(-c2c(-c3ccsc3)noc2C(N)=O)s1 |
| InChI | InChI=1S/C17H13N5O4S3/c1-8-6-10(18)2-3-11(8)29(24,25)17-21-20-16(28-17)12-13(9-4-5-27-7-9)22-26-14(12)15(19)23/h2-7H,18H2,1H3,(H2,19,23) |
| InChIKey | WMLDVUBOSRXEGO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 155.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|