About 1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine
1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine (PubChem CID 175872441) has the molecular formula C12H17N5O
and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine.
Molecular Properties
| Compound Name | 1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine |
| PubChem CID | 175872441 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine |
| SMILES | C[C@@H]([C@H]1CCCOC1)n1ncc2ncc(N)nc21 |
| InChI | InChI=1S/C12H17N5O/c1-8(9-3-2-4-18-7-9)17-12-10(5-15-17)14-6-11(13)16-12/h5-6,8-9H,2-4,7H2,1H3,(H2,13,16)/t8-,9-/m0/s1 |
| InChIKey | CWJSEFOEVXRVNM-IUCAKERBSA-N |
| XLogP | 1.40 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine?
The IUPAC name of 1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine (CID 175872441) is 1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine.
What is the SMILES notation for 1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine?
The canonical SMILES for 1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine is C[C@@H]([C@H]1CCCOC1)n1ncc2ncc(N)nc21.
What is the InChIKey of 1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine?
The InChIKey is CWJSEFOEVXRVNM-IUCAKERBSA-N. The full InChI is InChI=1S/C12H17N5O/c1-8(9-3-2-4-18-7-9)17-12-10(5-15-17)14-6-11(13)16-12/h5-6,8-9H,2-4,7H2,1H3,(H2,13,16)/t8-,9-/m0/s1.
What are the key properties of 1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine?
1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine has a molecular weight of 247.30 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-1-[(3R)-oxan-3-yl]ethyl]pyrazolo[3,4-b]pyrazin-6-amine is sourced from PubChem (CID 175872441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).