C9H14N4O2 — CID 175872921
2-prop-2-enyl-1,3,6,8,9,9a-hexahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione (PubChem CID 175872921) has the molecular formula C9H14N4O2 and a molecular weight of 210.24 g/mol. Its IUPAC name is 2-prop-2-enyl-1,3,6,8,9,9a-hexahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione.
| Compound Name | 2-prop-2-enyl-1,3,6,8,9,9a-hexahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione |
|---|---|
| PubChem CID | 175872921 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-prop-2-enyl-1,3,6,8,9,9a-hexahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione |
| SMILES | C=CCN1CC(=O)N2CC(=O)NCC2N1 |
| InChI | InChI=1S/C9H14N4O2/c1-2-3-12-6-9(15)13-5-8(14)10-4-7(13)11-12/h2,7,11H,1,3-6H2,(H,10,14) |
| InChIKey | OHHANWIWGXSDNA-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|