About methyl 2-oxoindole-6-carboxylate;hydrochloride
methyl 2-oxoindole-6-carboxylate;hydrochloride (PubChem CID 175873027) has the molecular formula C10H8ClNO3
and a molecular weight of 225.63 g/mol. Its IUPAC name is methyl 2-oxoindole-6-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-oxoindole-6-carboxylate;hydrochloride |
| PubChem CID | 175873027 |
| Molecular Formula | C10H8ClNO3 |
| Molecular Weight | 225.63 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | methyl 2-oxoindole-6-carboxylate;hydrochloride |
| SMILES | COC(=O)c1ccc2c(c1)=NC(=O)C=2.Cl |
| InChI | InChI=1S/C10H7NO3.ClH/c1-14-10(13)7-3-2-6-5-9(12)11-8(6)4-7;/h2-5H,1H3;1H |
| InChIKey | VTKVZOIJAMKPOP-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.63 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-oxoindole-6-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-oxoindole-6-carboxylate;hydrochloride?
The IUPAC name of methyl 2-oxoindole-6-carboxylate;hydrochloride (CID 175873027) is methyl 2-oxoindole-6-carboxylate;hydrochloride.
What is the SMILES notation for methyl 2-oxoindole-6-carboxylate;hydrochloride?
The canonical SMILES for methyl 2-oxoindole-6-carboxylate;hydrochloride is COC(=O)c1ccc2c(c1)=NC(=O)C=2.Cl.
What is the InChIKey of methyl 2-oxoindole-6-carboxylate;hydrochloride?
The InChIKey is VTKVZOIJAMKPOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO3.ClH/c1-14-10(13)7-3-2-6-5-9(12)11-8(6)4-7;/h2-5H,1H3;1H.
What are the key properties of methyl 2-oxoindole-6-carboxylate;hydrochloride?
methyl 2-oxoindole-6-carboxylate;hydrochloride has a molecular weight of 225.63 g/mol, XLogP of -0.16, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-oxoindole-6-carboxylate;hydrochloride is sourced from PubChem (CID 175873027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).