About 3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione
3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione (PubChem CID 175873288) has the molecular formula C8H7N3O2S
and a molecular weight of 209.23 g/mol. Its IUPAC name is 3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 175873288 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | 3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc[nH]c(=O)n1Cc1cscn1 |
| InChI | InChI=1S/C8H7N3O2S/c12-7-1-2-9-8(13)11(7)3-6-4-14-5-10-6/h1-2,4-5H,3H2,(H,9,13) |
| InChIKey | HKHSCZRMZKBKHZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione (CID 175873288) is 3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione is O=c1cc[nH]c(=O)n1Cc1cscn1.
What is the InChIKey of 3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione?
The InChIKey is HKHSCZRMZKBKHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2S/c12-7-1-2-9-8(13)11(7)3-6-4-14-5-10-6/h1-2,4-5H,3H2,(H,9,13).
What are the key properties of 3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione?
3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione has a molecular weight of 209.23 g/mol, XLogP of 0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-thiazol-4-ylmethyl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 175873288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).