C28H46F2N4O2SSi — CID 175873585
[[(1S)-1-[6-[(R)-amino(cyclopropyl)methyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-2-[(1R)-3,3-difluorocyclopentyl]ethyl]amino]-tert-butyl-oxidosulfanium (PubChem CID 175873585) has the molecular formula C28H46F2N4O2SSi and a molecular weight of 568.85 g/mol. Its IUPAC name is [[(1S)-1-[6-[(R)-amino(cyclopropyl)methyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-2-[(1R)-3,3-difluorocyclopentyl]ethyl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(1S)-1-[6-[(R)-amino(cyclopropyl)methyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-2-[(1R)-3,3-difluorocyclopentyl]ethyl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 175873585 |
| Molecular Formula | C28H46F2N4O2SSi |
| Molecular Weight | 568.85 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | [[(1S)-1-[6-[(R)-amino(cyclopropyl)methyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-2-[(1R)-3,3-difluorocyclopentyl]ethyl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@@H](C[C@H]1CCC(F)(F)C1)c1nc2ccc([C@H](N)C3CC3)cc2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C28H46F2N4O2SSi/c1-27(2,3)37(35)33-23(15-19-11-12-28(29,30)17-19)26-32-22-10-9-21(25(31)20-7-8-20)16-24(22)34(26)18-36-13-14-38(4,5)6/h9-10,16,19-20,23,25,33H,7-8,11-15,17-18,31H2,1-6H3/t19-,23+,25-,37?/m1/s1 |
| InChIKey | HFFCBTJCZXBWAO-PTQFTKBRSA-N |
| XLogP | 6.68 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.85 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|