About 2-ethyl-1-propylpyrrole;hydrofluoride
2-ethyl-1-propylpyrrole;hydrofluoride (PubChem CID 175874487) has the molecular formula C9H16FN
and a molecular weight of 157.23 g/mol. Its IUPAC name is 2-ethyl-1-propylpyrrole;hydrofluoride.
Molecular Properties
| Compound Name | 2-ethyl-1-propylpyrrole;hydrofluoride |
| PubChem CID | 175874487 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 2-ethyl-1-propylpyrrole;hydrofluoride |
| SMILES | CCCn1cccc1CC.F |
| InChI | InChI=1S/C9H15N.FH/c1-3-7-10-8-5-6-9(10)4-2;/h5-6,8H,3-4,7H2,1-2H3;1H |
| InChIKey | MEKACRLEYFMRKQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-1-propylpyrrole;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-propylpyrrole;hydrofluoride?
The IUPAC name of 2-ethyl-1-propylpyrrole;hydrofluoride (CID 175874487) is 2-ethyl-1-propylpyrrole;hydrofluoride.
What is the SMILES notation for 2-ethyl-1-propylpyrrole;hydrofluoride?
The canonical SMILES for 2-ethyl-1-propylpyrrole;hydrofluoride is CCCn1cccc1CC.F.
What is the InChIKey of 2-ethyl-1-propylpyrrole;hydrofluoride?
The InChIKey is MEKACRLEYFMRKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N.FH/c1-3-7-10-8-5-6-9(10)4-2;/h5-6,8H,3-4,7H2,1-2H3;1H.
What are the key properties of 2-ethyl-1-propylpyrrole;hydrofluoride?
2-ethyl-1-propylpyrrole;hydrofluoride has a molecular weight of 157.23 g/mol, XLogP of 2.61, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-propylpyrrole;hydrofluoride is sourced from PubChem (CID 175874487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).