About acetic acid;1-nonylpiperidine
acetic acid;1-nonylpiperidine (PubChem CID 175874764) has the molecular formula C16H33NO2
and a molecular weight of 271.44 g/mol. Its IUPAC name is acetic acid;1-nonylpiperidine.
Molecular Properties
| Compound Name | acetic acid;1-nonylpiperidine |
| PubChem CID | 175874764 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | acetic acid;1-nonylpiperidine |
| SMILES | CC(=O)O.CCCCCCCCCN1CCCCC1 |
| InChI | InChI=1S/C14H29N.C2H4O2/c1-2-3-4-5-6-7-9-12-15-13-10-8-11-14-15;1-2(3)4/h2-14H2,1H3;1H3,(H,3,4) |
| InChIKey | FRQSUJRPNJLXEF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;1-nonylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-nonylpiperidine?
The IUPAC name of acetic acid;1-nonylpiperidine (CID 175874764) is acetic acid;1-nonylpiperidine.
What is the SMILES notation for acetic acid;1-nonylpiperidine?
The canonical SMILES for acetic acid;1-nonylpiperidine is CC(=O)O.CCCCCCCCCN1CCCCC1.
What is the InChIKey of acetic acid;1-nonylpiperidine?
The InChIKey is FRQSUJRPNJLXEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N.C2H4O2/c1-2-3-4-5-6-7-9-12-15-13-10-8-11-14-15;1-2(3)4/h2-14H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-nonylpiperidine?
acetic acid;1-nonylpiperidine has a molecular weight of 271.44 g/mol, XLogP of 4.31, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-nonylpiperidine is sourced from PubChem (CID 175874764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).