About 2-butyl-1-dodecylpyrrolidine;formonitrile
2-butyl-1-dodecylpyrrolidine;formonitrile (PubChem CID 175874902) has the molecular formula C21H42N2
and a molecular weight of 322.58 g/mol. Its IUPAC name is 2-butyl-1-dodecylpyrrolidine;formonitrile.
Molecular Properties
| Compound Name | 2-butyl-1-dodecylpyrrolidine;formonitrile |
| PubChem CID | 175874902 |
| Molecular Formula | C21H42N2 |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.33 |
| IUPAC Name | 2-butyl-1-dodecylpyrrolidine;formonitrile |
| SMILES | C#N.CCCCCCCCCCCCN1CCCC1CCCC |
| InChI | InChI=1S/C20H41N.CHN/c1-3-5-7-8-9-10-11-12-13-14-18-21-19-15-17-20(21)16-6-4-2;1-2/h20H,3-19H2,1-2H3;1H |
| InChIKey | LXKSTVXOAXKCQZ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-1-dodecylpyrrolidine;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1-dodecylpyrrolidine;formonitrile?
The IUPAC name of 2-butyl-1-dodecylpyrrolidine;formonitrile (CID 175874902) is 2-butyl-1-dodecylpyrrolidine;formonitrile.
What is the SMILES notation for 2-butyl-1-dodecylpyrrolidine;formonitrile?
The canonical SMILES for 2-butyl-1-dodecylpyrrolidine;formonitrile is C#N.CCCCCCCCCCCCN1CCCC1CCCC.
What is the InChIKey of 2-butyl-1-dodecylpyrrolidine;formonitrile?
The InChIKey is LXKSTVXOAXKCQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41N.CHN/c1-3-5-7-8-9-10-11-12-13-14-18-21-19-15-17-20(21)16-6-4-2;1-2/h20H,3-19H2,1-2H3;1H.
What are the key properties of 2-butyl-1-dodecylpyrrolidine;formonitrile?
2-butyl-1-dodecylpyrrolidine;formonitrile has a molecular weight of 322.58 g/mol, XLogP of 6.70, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1-dodecylpyrrolidine;formonitrile is sourced from PubChem (CID 175874902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).