About 3-butyl-1-pentylpiperidine;formonitrile
3-butyl-1-pentylpiperidine;formonitrile (PubChem CID 175874905) has the molecular formula C15H30N2
and a molecular weight of 238.42 g/mol. Its IUPAC name is 3-butyl-1-pentylpiperidine;formonitrile.
Molecular Properties
| Compound Name | 3-butyl-1-pentylpiperidine;formonitrile |
| PubChem CID | 175874905 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 3-butyl-1-pentylpiperidine;formonitrile |
| SMILES | C#N.CCCCCN1CCCC(CCCC)C1 |
| InChI | InChI=1S/C14H29N.CHN/c1-3-5-7-11-15-12-8-10-14(13-15)9-6-4-2;1-2/h14H,3-13H2,1-2H3;1H |
| InChIKey | GJCQNEVYVVHVRV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-1-pentylpiperidine;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-1-pentylpiperidine;formonitrile?
The IUPAC name of 3-butyl-1-pentylpiperidine;formonitrile (CID 175874905) is 3-butyl-1-pentylpiperidine;formonitrile.
What is the SMILES notation for 3-butyl-1-pentylpiperidine;formonitrile?
The canonical SMILES for 3-butyl-1-pentylpiperidine;formonitrile is C#N.CCCCCN1CCCC(CCCC)C1.
What is the InChIKey of 3-butyl-1-pentylpiperidine;formonitrile?
The InChIKey is GJCQNEVYVVHVRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29N.CHN/c1-3-5-7-11-15-12-8-10-14(13-15)9-6-4-2;1-2/h14H,3-13H2,1-2H3;1H.
What are the key properties of 3-butyl-1-pentylpiperidine;formonitrile?
3-butyl-1-pentylpiperidine;formonitrile has a molecular weight of 238.42 g/mol, XLogP of 4.22, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-1-pentylpiperidine;formonitrile is sourced from PubChem (CID 175874905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).