About 1-butyl-2-ethylpyrrole;formonitrile
1-butyl-2-ethylpyrrole;formonitrile (PubChem CID 175875001) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-butyl-2-ethylpyrrole;formonitrile.
Molecular Properties
| Compound Name | 1-butyl-2-ethylpyrrole;formonitrile |
| PubChem CID | 175875001 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-butyl-2-ethylpyrrole;formonitrile |
| SMILES | C#N.CCCCn1cccc1CC |
| InChI | InChI=1S/C10H17N.CHN/c1-3-5-8-11-9-6-7-10(11)4-2;1-2/h6-7,9H,3-5,8H2,1-2H3;1H |
| InChIKey | JIFJHWMRZBMGDA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-butyl-2-ethylpyrrole;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-ethylpyrrole;formonitrile?
The IUPAC name of 1-butyl-2-ethylpyrrole;formonitrile (CID 175875001) is 1-butyl-2-ethylpyrrole;formonitrile.
What is the SMILES notation for 1-butyl-2-ethylpyrrole;formonitrile?
The canonical SMILES for 1-butyl-2-ethylpyrrole;formonitrile is C#N.CCCCn1cccc1CC.
What is the InChIKey of 1-butyl-2-ethylpyrrole;formonitrile?
The InChIKey is JIFJHWMRZBMGDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N.CHN/c1-3-5-8-11-9-6-7-10(11)4-2;1-2/h6-7,9H,3-5,8H2,1-2H3;1H.
What are the key properties of 1-butyl-2-ethylpyrrole;formonitrile?
1-butyl-2-ethylpyrrole;formonitrile has a molecular weight of 178.28 g/mol, XLogP of 2.99, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-ethylpyrrole;formonitrile is sourced from PubChem (CID 175875001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).