C19H20ClN7 — CID 175875574
2-chloro-8-methyl-9-propan-2-yl-N-[(2-pyrazol-1-ylphenyl)methyl]purin-6-amine (PubChem CID 175875574) has the molecular formula C19H20ClN7 and a molecular weight of 381.87 g/mol. Its IUPAC name is 2-chloro-8-methyl-9-propan-2-yl-N-[(2-pyrazol-1-ylphenyl)methyl]purin-6-amine.
| Compound Name | 2-chloro-8-methyl-9-propan-2-yl-N-[(2-pyrazol-1-ylphenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 175875574 |
| Molecular Formula | C19H20ClN7 |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-chloro-8-methyl-9-propan-2-yl-N-[(2-pyrazol-1-ylphenyl)methyl]purin-6-amine |
| SMILES | Cc1nc2c(NCc3ccccc3-n3cccn3)nc(Cl)nc2n1C(C)C |
| InChI | InChI=1S/C19H20ClN7/c1-12(2)27-13(3)23-16-17(24-19(20)25-18(16)27)21-11-14-7-4-5-8-15(14)26-10-6-9-22-26/h4-10,12H,11H2,1-3H3,(H,21,24,25) |
| InChIKey | ITAUASHTUUKRHW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |