C21H16Cl2F4N4O2 — CID 175875935
2-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-prop-2-enyl-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide (PubChem CID 175875935) has the molecular formula C21H16Cl2F4N4O2 and a molecular weight of 503.28 g/mol. Its IUPAC name is 2-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-prop-2-enyl-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide.
| Compound Name | 2-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-prop-2-enyl-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 175875935 |
| Molecular Formula | C21H16Cl2F4N4O2 |
| Molecular Weight | 503.28 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | 2-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-prop-2-enyl-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide |
| SMILES | C=CCNC(=O)c1cc2c(cn1)CN(C1=NOC(c3cc(Cl)c(F)c(Cl)c3)(C(F)(F)F)C1)C2 |
| InChI | InChI=1S/C21H16Cl2F4N4O2/c1-2-3-28-19(32)16-4-11-9-31(10-12(11)8-29-16)17-7-20(33-30-17,21(25,26)27)13-5-14(22)18(24)15(23)6-13/h2,4-6,8H,1,3,7,9-10H2,(H,28,32) |
| InChIKey | GRJHPWPRCCAYIS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.28 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|