C21H17Cl2F6N3O2S — CID 175876097
5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-3-methyl-N-(1,1,1-trifluoropropan-2-yl)-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide (PubChem CID 175876097) has the molecular formula C21H17Cl2F6N3O2S and a molecular weight of 560.35 g/mol. Its IUPAC name is 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-3-methyl-N-(1,1,1-trifluoropropan-2-yl)-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide.
| Compound Name | 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-3-methyl-N-(1,1,1-trifluoropropan-2-yl)-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 175876097 |
| Molecular Formula | C21H17Cl2F6N3O2S |
| Molecular Weight | 560.35 g/mol |
| Exact Mass | 559.03 |
| IUPAC Name | 5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-3-methyl-N-(1,1,1-trifluoropropan-2-yl)-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)C(F)(F)F)sc2c1CN(C1=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C1)C2 |
| InChI | InChI=1S/C21H17Cl2F6N3O2S/c1-9-14-7-32(8-15(14)35-17(9)18(33)30-10(2)20(24,25)26)16-6-19(34-31-16,21(27,28)29)11-3-12(22)5-13(23)4-11/h3-5,10H,6-8H2,1-2H3,(H,30,33) |
| InChIKey | JWRXRNLHNIXLNF-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.35 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |