C20H14Cl2F6N4O2 — CID 175876194
2-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2,2,2-trifluoroethyl)-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide (PubChem CID 175876194) has the molecular formula C20H14Cl2F6N4O2 and a molecular weight of 527.25 g/mol. Its IUPAC name is 2-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2,2,2-trifluoroethyl)-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide.
| Compound Name | 2-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2,2,2-trifluoroethyl)-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 175876194 |
| Molecular Formula | C20H14Cl2F6N4O2 |
| Molecular Weight | 527.25 g/mol |
| Exact Mass | 526.04 |
| IUPAC Name | 2-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2,2,2-trifluoroethyl)-1,3-dihydropyrrolo[3,4-c]pyridine-6-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1cc2c(cn1)CN(C1=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C1)C2 |
| InChI | InChI=1S/C20H14Cl2F6N4O2/c21-13-2-12(3-14(22)4-13)18(20(26,27)28)5-16(31-34-18)32-7-10-1-15(29-6-11(10)8-32)17(33)30-9-19(23,24)25/h1-4,6H,5,7-9H2,(H,30,33) |
| InChIKey | GGGNYECONZAPOJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.25 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |