About arsorous acid;dimethoxyarsinic acid
arsorous acid;dimethoxyarsinic acid (PubChem CID 175876438) has the molecular formula C2H10As2O7
and a molecular weight of 295.94 g/mol. Its IUPAC name is arsorous acid;dimethoxyarsinic acid.
Molecular Properties
| Compound Name | arsorous acid;dimethoxyarsinic acid |
| PubChem CID | 175876438 |
| Molecular Formula | C2H10As2O7 |
| Molecular Weight | 295.94 g/mol |
| Exact Mass | 295.89 |
| IUPAC Name | arsorous acid;dimethoxyarsinic acid |
| SMILES | CO[As](=O)(O)OC.O[As](O)O |
| InChI | InChI=1S/C2H7AsO4.AsH3O3/c1-6-3(4,5)7-2;2-1(3)4/h1-2H3,(H,4,5);2-4H |
| InChIKey | HEYSMQLLYORSLU-UHFFFAOYSA-N |
| XLogP | -2.91 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.94 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze arsorous acid;dimethoxyarsinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of arsorous acid;dimethoxyarsinic acid?
The IUPAC name of arsorous acid;dimethoxyarsinic acid (CID 175876438) is arsorous acid;dimethoxyarsinic acid.
What is the SMILES notation for arsorous acid;dimethoxyarsinic acid?
The canonical SMILES for arsorous acid;dimethoxyarsinic acid is CO[As](=O)(O)OC.O[As](O)O.
What is the InChIKey of arsorous acid;dimethoxyarsinic acid?
The InChIKey is HEYSMQLLYORSLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7AsO4.AsH3O3/c1-6-3(4,5)7-2;2-1(3)4/h1-2H3,(H,4,5);2-4H.
What are the key properties of arsorous acid;dimethoxyarsinic acid?
arsorous acid;dimethoxyarsinic acid has a molecular weight of 295.94 g/mol, XLogP of -2.91, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for arsorous acid;dimethoxyarsinic acid is sourced from PubChem (CID 175876438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).