arsorous acid;dimethoxyarsinic acid

C2H10As2O7 — CID 175876438

IUPACarsorous acid;dimethoxyarsinic acid
SMILESCO[As](=O)(O)OC.O[As](O)O
InChIInChI=1S/C2H7AsO4.AsH3O3/c1-6-3(4,5)7-2;2-1(3)4/h1-2H3,(H,4,5);2-4H
InChIKeyHEYSMQLLYORSLU-UHFFFAOYSA-N
MW295.94 g/mol
LogP-2.91
Rot. Bonds2

About arsorous acid;dimethoxyarsinic acid

arsorous acid;dimethoxyarsinic acid (PubChem CID 175876438) has the molecular formula C2H10As2O7 and a molecular weight of 295.94 g/mol. Its IUPAC name is arsorous acid;dimethoxyarsinic acid.

Molecular Properties

Compound Namearsorous acid;dimethoxyarsinic acid
PubChem CID175876438
Molecular FormulaC2H10As2O7
Molecular Weight295.94 g/mol
Exact Mass295.89
IUPAC Namearsorous acid;dimethoxyarsinic acid
SMILESCO[As](=O)(O)OC.O[As](O)O
InChIInChI=1S/C2H7AsO4.AsH3O3/c1-6-3(4,5)7-2;2-1(3)4/h1-2H3,(H,4,5);2-4H
InChIKeyHEYSMQLLYORSLU-UHFFFAOYSA-N
XLogP-2.91
TPSA116.45 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.94
LogP ≤ 5-2.91
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze arsorous acid;dimethoxyarsinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of arsorous acid;dimethoxyarsinic acid?
The IUPAC name of arsorous acid;dimethoxyarsinic acid (CID 175876438) is arsorous acid;dimethoxyarsinic acid.
What is the SMILES notation for arsorous acid;dimethoxyarsinic acid?
The canonical SMILES for arsorous acid;dimethoxyarsinic acid is CO[As](=O)(O)OC.O[As](O)O.
What is the InChIKey of arsorous acid;dimethoxyarsinic acid?
The InChIKey is HEYSMQLLYORSLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7AsO4.AsH3O3/c1-6-3(4,5)7-2;2-1(3)4/h1-2H3,(H,4,5);2-4H.
What are the key properties of arsorous acid;dimethoxyarsinic acid?
arsorous acid;dimethoxyarsinic acid has a molecular weight of 295.94 g/mol, XLogP of -2.91, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for arsorous acid;dimethoxyarsinic acid is sourced from PubChem (CID 175876438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).