About [(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate
[(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate (PubChem CID 175877053) has the molecular formula C17H26NO4P
and a molecular weight of 339.37 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate.
Molecular Properties
| Compound Name | [(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate |
| PubChem CID | 175877053 |
| Molecular Formula | C17H26NO4P |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | [(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate |
| SMILES | C[C@H](NPOc1ccc(C(C)(C)C)cc1)C(=O)O[C@H]1CCOC1 |
| InChI | InChI=1S/C17H26NO4P/c1-12(16(19)21-15-9-10-20-11-15)18-23-22-14-7-5-13(6-8-14)17(2,3)4/h5-8,12,15,18,23H,9-11H2,1-4H3/t12-,15-/m0/s1 |
| InChIKey | WFUBRMDKJCSEGV-WFASDCNBSA-N |
| XLogP | 3.18 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate?
The IUPAC name of [(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate (CID 175877053) is [(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate.
What is the SMILES notation for [(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate?
The canonical SMILES for [(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate is C[C@H](NPOc1ccc(C(C)(C)C)cc1)C(=O)O[C@H]1CCOC1.
What is the InChIKey of [(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate?
The InChIKey is WFUBRMDKJCSEGV-WFASDCNBSA-N. The full InChI is InChI=1S/C17H26NO4P/c1-12(16(19)21-15-9-10-20-11-15)18-23-22-14-7-5-13(6-8-14)17(2,3)4/h5-8,12,15,18,23H,9-11H2,1-4H3/t12-,15-/m0/s1.
What are the key properties of [(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate?
[(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate has a molecular weight of 339.37 g/mol, XLogP of 3.18, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-oxolan-3-yl] (2S)-2-[(4-tert-butylphenoxy)phosphanylamino]propanoate is sourced from PubChem (CID 175877053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).