C18H21F4N5O3 — CID 175877165
2-[3-[(2,6-dioxopiperidin-3-yl)amino]-5-fluorophenyl]-2-[(2R)-2-(trifluoromethyl)piperazin-1-yl]acetamide (PubChem CID 175877165) has the molecular formula C18H21F4N5O3 and a molecular weight of 431.39 g/mol. Its IUPAC name is 2-[3-[(2,6-dioxopiperidin-3-yl)amino]-5-fluorophenyl]-2-[(2R)-2-(trifluoromethyl)piperazin-1-yl]acetamide.
| Compound Name | 2-[3-[(2,6-dioxopiperidin-3-yl)amino]-5-fluorophenyl]-2-[(2R)-2-(trifluoromethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 175877165 |
| Molecular Formula | C18H21F4N5O3 |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2-[3-[(2,6-dioxopiperidin-3-yl)amino]-5-fluorophenyl]-2-[(2R)-2-(trifluoromethyl)piperazin-1-yl]acetamide |
| SMILES | NC(=O)C(c1cc(F)cc(NC2CCC(=O)NC2=O)c1)N1CCNC[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C18H21F4N5O3/c19-10-5-9(6-11(7-10)25-12-1-2-14(28)26-17(12)30)15(16(23)29)27-4-3-24-8-13(27)18(20,21)22/h5-7,12-13,15,24-25H,1-4,8H2,(H2,23,29)(H,26,28,30)/t12?,13-,15?/m1/s1 |
| InChIKey | LIKCQURNIIWNOB-JVWICGRDSA-N |
| XLogP | 0.41 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|