C21H18F4N2O2 — CID 175877565
3,3,3-trifluoroprop-1-en-2-yl 3-(7-fluoro-3-phenylindazol-1-yl)-2,2-dimethylpropanoate (PubChem CID 175877565) has the molecular formula C21H18F4N2O2 and a molecular weight of 406.38 g/mol. Its IUPAC name is 3,3,3-trifluoroprop-1-en-2-yl 3-(7-fluoro-3-phenylindazol-1-yl)-2,2-dimethylpropanoate.
| Compound Name | 3,3,3-trifluoroprop-1-en-2-yl 3-(7-fluoro-3-phenylindazol-1-yl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175877565 |
| Molecular Formula | C21H18F4N2O2 |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 3,3,3-trifluoroprop-1-en-2-yl 3-(7-fluoro-3-phenylindazol-1-yl)-2,2-dimethylpropanoate |
| SMILES | C=C(OC(=O)C(C)(C)Cn1nc(-c2ccccc2)c2cccc(F)c21)C(F)(F)F |
| InChI | InChI=1S/C21H18F4N2O2/c1-13(21(23,24)25)29-19(28)20(2,3)12-27-18-15(10-7-11-16(18)22)17(26-27)14-8-5-4-6-9-14/h4-11H,1,12H2,2-3H3 |
| InChIKey | UVGKJFNSPJRKKC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|