C19H21F2NO2 — CID 175877686
2-[3-fluoro-2-(4-fluorophenyl)-6-(oxan-2-yl)-4-pyridinyl]propan-2-ol (PubChem CID 175877686) has the molecular formula C19H21F2NO2 and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-[3-fluoro-2-(4-fluorophenyl)-6-(oxan-2-yl)-4-pyridinyl]propan-2-ol.
| Compound Name | 2-[3-fluoro-2-(4-fluorophenyl)-6-(oxan-2-yl)-4-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 175877686 |
| Molecular Formula | C19H21F2NO2 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-[3-fluoro-2-(4-fluorophenyl)-6-(oxan-2-yl)-4-pyridinyl]propan-2-ol |
| SMILES | CC(C)(O)c1cc(C2CCCCO2)nc(-c2ccc(F)cc2)c1F |
| InChI | InChI=1S/C19H21F2NO2/c1-19(2,23)14-11-15(16-5-3-4-10-24-16)22-18(17(14)21)12-6-8-13(20)9-7-12/h6-9,11,16,23H,3-5,10H2,1-2H3 |
| InChIKey | KGAZAUWLJBPDHG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |