About (1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol
(1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol (PubChem CID 175879148) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is (1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol.
Molecular Properties
| Compound Name | (1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol |
| PubChem CID | 175879148 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol |
| SMILES | CC(C)(C)C1=NC(CO)Cc2ccccc21 |
| InChI | InChI=1S/C14H19NO/c1-14(2,3)13-12-7-5-4-6-10(12)8-11(9-16)15-13/h4-7,11,16H,8-9H2,1-3H3 |
| InChIKey | AZVJOFFGENTGQU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol?
The IUPAC name of (1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol (CID 175879148) is (1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol.
What is the SMILES notation for (1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol?
The canonical SMILES for (1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol is CC(C)(C)C1=NC(CO)Cc2ccccc21.
What is the InChIKey of (1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol?
The InChIKey is AZVJOFFGENTGQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c1-14(2,3)13-12-7-5-4-6-10(12)8-11(9-16)15-13/h4-7,11,16H,8-9H2,1-3H3.
What are the key properties of (1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol?
(1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol has a molecular weight of 217.31 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tert-butyl-3,4-dihydroisoquinolin-3-yl)methanol is sourced from PubChem (CID 175879148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).