About 2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate
2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate (PubChem CID 175879867) has the molecular formula C21H23N3O4S
and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate.
Molecular Properties
| Compound Name | 2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate |
| PubChem CID | 175879867 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate |
| SMILES | CC(=O)OCCc1csc(-c2cc3ccc(N4CCN(C)CC4)cc3oc2=O)n1 |
| InChI | InChI=1S/C21H23N3O4S/c1-14(25)27-10-5-16-13-29-20(22-16)18-11-15-3-4-17(12-19(15)28-21(18)26)24-8-6-23(2)7-9-24/h3-4,11-13H,5-10H2,1-2H3 |
| InChIKey | GBICQTCZFLSSNQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 75.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate?
The IUPAC name of 2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate (CID 175879867) is 2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate.
What is the SMILES notation for 2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate?
The canonical SMILES for 2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate is CC(=O)OCCc1csc(-c2cc3ccc(N4CCN(C)CC4)cc3oc2=O)n1.
What is the InChIKey of 2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate?
The InChIKey is GBICQTCZFLSSNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O4S/c1-14(25)27-10-5-16-13-29-20(22-16)18-11-15-3-4-17(12-19(15)28-21(18)26)24-8-6-23(2)7-9-24/h3-4,11-13H,5-10H2,1-2H3.
What are the key properties of 2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate?
2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate has a molecular weight of 413.50 g/mol, XLogP of 2.77, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[7-(4-methylpiperazin-1-yl)-2-oxochromen-3-yl]-1,3-thiazol-4-yl]ethyl acetate is sourced from PubChem (CID 175879867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).