C23H19N5O6S2 — CID 175879897
5-[anilino(1,3,5-triazin-2-yl)amino]-2-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid (PubChem CID 175879897) has the molecular formula C23H19N5O6S2 and a molecular weight of 525.57 g/mol. Its IUPAC name is 5-[anilino(1,3,5-triazin-2-yl)amino]-2-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid.
| Compound Name | 5-[anilino(1,3,5-triazin-2-yl)amino]-2-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 175879897 |
| Molecular Formula | C23H19N5O6S2 |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 5-[anilino(1,3,5-triazin-2-yl)amino]-2-[2-(2-sulfophenyl)ethenyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1C=Cc1ccc(N(Nc2ccccc2)c2ncncn2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C23H19N5O6S2/c29-35(30,31)21-9-5-4-6-17(21)10-11-18-12-13-20(14-22(18)36(32,33)34)28(23-25-15-24-16-26-23)27-19-7-2-1-3-8-19/h1-16,27H,(H,29,30,31)(H,32,33,34) |
| InChIKey | BWJKMTMCOOBOOV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 162.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|