About [4-(aminomethyl)phenyl]methanamine;tetrachlorostannane
[4-(aminomethyl)phenyl]methanamine;tetrachlorostannane (PubChem CID 175880044) has the molecular formula C8H12Cl4N2Sn
and a molecular weight of 396.72 g/mol. Its IUPAC name is [4-(aminomethyl)phenyl]methanamine;tetrachlorostannane.
Molecular Properties
| Compound Name | [4-(aminomethyl)phenyl]methanamine;tetrachlorostannane |
| PubChem CID | 175880044 |
| Molecular Formula | C8H12Cl4N2Sn |
| Molecular Weight | 396.72 g/mol |
| Exact Mass | 395.88 |
| IUPAC Name | [4-(aminomethyl)phenyl]methanamine;tetrachlorostannane |
| SMILES | Cl[Sn](Cl)(Cl)Cl.NCc1ccc(CN)cc1 |
| InChI | InChI=1S/C8H12N2.4ClH.Sn/c9-5-7-1-2-8(6-10)4-3-7;;;;;/h1-4H,5-6,9-10H2;4*1H;/q;;;;;+4/p-4 |
| InChIKey | TXNIIEZUCJVHCE-UHFFFAOYSA-J |
| XLogP | 2.98 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.72 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(aminomethyl)phenyl]methanamine;tetrachlorostannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(aminomethyl)phenyl]methanamine;tetrachlorostannane?
The IUPAC name of [4-(aminomethyl)phenyl]methanamine;tetrachlorostannane (CID 175880044) is [4-(aminomethyl)phenyl]methanamine;tetrachlorostannane.
What is the SMILES notation for [4-(aminomethyl)phenyl]methanamine;tetrachlorostannane?
The canonical SMILES for [4-(aminomethyl)phenyl]methanamine;tetrachlorostannane is Cl[Sn](Cl)(Cl)Cl.NCc1ccc(CN)cc1.
What is the InChIKey of [4-(aminomethyl)phenyl]methanamine;tetrachlorostannane?
The InChIKey is TXNIIEZUCJVHCE-UHFFFAOYSA-J. The full InChI is InChI=1S/C8H12N2.4ClH.Sn/c9-5-7-1-2-8(6-10)4-3-7;;;;;/h1-4H,5-6,9-10H2;4*1H;/q;;;;;+4/p-4.
What are the key properties of [4-(aminomethyl)phenyl]methanamine;tetrachlorostannane?
[4-(aminomethyl)phenyl]methanamine;tetrachlorostannane has a molecular weight of 396.72 g/mol, XLogP of 2.98, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(aminomethyl)phenyl]methanamine;tetrachlorostannane is sourced from PubChem (CID 175880044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).