About 5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one
5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one (PubChem CID 175880423) has the molecular formula C18H23FN4O
and a molecular weight of 330.40 g/mol. Its IUPAC name is 5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one |
| PubChem CID | 175880423 |
| Molecular Formula | C18H23FN4O |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one |
| SMILES | C1CC(CNC1)N2CC3=CC(=C(C=C3C2=O)F)N4C5CC4CNC5 |
| InChI | InChI=1S/C18H23FN4O/c19-16-6-15-11(4-17(16)23-13-5-14(23)9-21-8-13)10-22(18(15)24)12-2-1-3-20-7-12/h4,6,12-14,20-21H,1-3,5,7-10H2 |
| InChIKey | GHNVQXJAZFEMNX-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 47.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | 507 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one?
The IUPAC name of 5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one (CID 175880423) is 5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one.
What is the SMILES notation for 5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one?
The canonical SMILES for 5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one is C1CC(CNC1)N2CC3=CC(=C(C=C3C2=O)F)N4C5CC4CNC5.
What is the InChIKey of 5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one?
The InChIKey is GHNVQXJAZFEMNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23FN4O/c19-16-6-15-11(4-17(16)23-13-5-14(23)9-21-8-13)10-22(18(15)24)12-2-1-3-20-7-12/h4,6,12-14,20-21H,1-3,5,7-10H2.
What are the key properties of 5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one?
5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one has a molecular weight of 330.40 g/mol, XLogP of 0.90, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,6-diazabicyclo[3.1.1]heptan-6-yl)-6-fluoro-2-piperidin-3-yl-3H-isoindol-1-one is sourced from PubChem (CID 175880423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).