C30H56O9SSi3 — CID 175880988
(2R,3S,4S)-6-(benzenesulfonyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxy-hydroxymethyl]-2H-pyran-3,4-diol (PubChem CID 175880988) has the molecular formula C30H56O9SSi3 and a molecular weight of 677.09 g/mol. Its IUPAC name is (2R,3S,4S)-6-(benzenesulfonyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxy-hydroxymethyl]-2H-pyran-3,4-diol.
| Compound Name | (2R,3S,4S)-6-(benzenesulfonyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxy-hydroxymethyl]-2H-pyran-3,4-diol |
|---|---|
| PubChem CID | 175880988 |
| Molecular Formula | C30H56O9SSi3 |
| Molecular Weight | 677.09 g/mol |
| Exact Mass | 676.30 |
| IUPAC Name | (2R,3S,4S)-6-(benzenesulfonyl)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[[tert-butyl(dimethyl)silyl]oxy-hydroxymethyl]-2H-pyran-3,4-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC(O)[C@H]1OC(S(=O)(=O)c2ccccc2)=C[C@](O)(O[Si](C)(C)C(C)(C)C)[C@@]1(O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H56O9SSi3/c1-26(2,3)41(10,11)37-25(31)24-30(33,39-43(14,15)28(7,8)9)29(32,38-42(12,13)27(4,5)6)21-23(36-24)40(34,35)22-19-17-16-18-20-22/h16-21,24-25,31-33H,1-15H3/t24-,25?,29+,30+/m1/s1 |
| InChIKey | PYQQRXWGFYRIDY-MUSKIQRSSA-N |
| XLogP | 6.46 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.09 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|