About 3-propyliminopropyl propanoate
3-propyliminopropyl propanoate (PubChem CID 175881019) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-propyliminopropyl propanoate.
Molecular Properties
| Compound Name | 3-propyliminopropyl propanoate |
| PubChem CID | 175881019 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 3-propyliminopropyl propanoate |
| SMILES | CCC/N=C/CCOC(=O)CC |
| InChI | InChI=1S/C9H17NO2/c1-3-6-10-7-5-8-12-9(11)4-2/h7H,3-6,8H2,1-2H3/b10-7+ |
| InChIKey | CPMSOXPRFTYANP-JXMROGBWSA-N |
| XLogP | 1.81 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-propyliminopropyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyliminopropyl propanoate?
The IUPAC name of 3-propyliminopropyl propanoate (CID 175881019) is 3-propyliminopropyl propanoate.
What is the SMILES notation for 3-propyliminopropyl propanoate?
The canonical SMILES for 3-propyliminopropyl propanoate is CCC/N=C/CCOC(=O)CC.
What is the InChIKey of 3-propyliminopropyl propanoate?
The InChIKey is CPMSOXPRFTYANP-JXMROGBWSA-N. The full InChI is InChI=1S/C9H17NO2/c1-3-6-10-7-5-8-12-9(11)4-2/h7H,3-6,8H2,1-2H3/b10-7+.
What are the key properties of 3-propyliminopropyl propanoate?
3-propyliminopropyl propanoate has a molecular weight of 171.24 g/mol, XLogP of 1.81, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyliminopropyl propanoate is sourced from PubChem (CID 175881019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).