C15H29NO2 — CID 175881063
(1S,2R,6R)-6-(tert-butylamino)-2-pentan-3-yloxycyclohex-3-en-1-ol (PubChem CID 175881063) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is (1S,2R,6R)-6-(tert-butylamino)-2-pentan-3-yloxycyclohex-3-en-1-ol.
| Compound Name | (1S,2R,6R)-6-(tert-butylamino)-2-pentan-3-yloxycyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 175881063 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | (1S,2R,6R)-6-(tert-butylamino)-2-pentan-3-yloxycyclohex-3-en-1-ol |
| SMILES | CCC(CC)O[C@@H]1C=CC[C@@H](NC(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C15H29NO2/c1-6-11(7-2)18-13-10-8-9-12(14(13)17)16-15(3,4)5/h8,10-14,16-17H,6-7,9H2,1-5H3/t12-,13-,14+/m1/s1 |
| InChIKey | YCGIUIJBDNSRFE-MCIONIFRSA-N |
| XLogP | 2.64 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|