C15H27NO — CID 175881064
(1R,2R,6R)-7-tert-butyl-2-pentan-3-yloxy-7-azabicyclo[4.1.0]hept-3-ene (PubChem CID 175881064) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (1R,2R,6R)-7-tert-butyl-2-pentan-3-yloxy-7-azabicyclo[4.1.0]hept-3-ene.
| Compound Name | (1R,2R,6R)-7-tert-butyl-2-pentan-3-yloxy-7-azabicyclo[4.1.0]hept-3-ene |
|---|---|
| PubChem CID | 175881064 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (1R,2R,6R)-7-tert-butyl-2-pentan-3-yloxy-7-azabicyclo[4.1.0]hept-3-ene |
| SMILES | CCC(CC)O[C@@H]1C=CC[C@@H]2[C@H]1N2C(C)(C)C |
| InChI | InChI=1S/C15H27NO/c1-6-11(7-2)17-13-10-8-9-12-14(13)16(12)15(3,4)5/h8,10-14H,6-7,9H2,1-5H3/t12-,13-,14-,16?/m1/s1 |
| InChIKey | VSPORQNAGYVTDN-QFBZGTDSSA-N |
| XLogP | 3.37 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|