C15H17F3N2O3 — CID 175881148
6-[2-(dimethylamino)ethyl]-1H-quinolin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 175881148) has the molecular formula C15H17F3N2O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is 6-[2-(dimethylamino)ethyl]-1H-quinolin-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 6-[2-(dimethylamino)ethyl]-1H-quinolin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175881148 |
| Molecular Formula | C15H17F3N2O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 6-[2-(dimethylamino)ethyl]-1H-quinolin-2-one;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCc1ccc2[nH]c(=O)ccc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H16N2O.C2HF3O2/c1-15(2)8-7-10-3-5-12-11(9-10)4-6-13(16)14-12;3-2(4,5)1(6)7/h3-6,9H,7-8H2,1-2H3,(H,14,16);(H,6,7) |
| InChIKey | RIVGLNYIJDBJAA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |