C14H18N4O — CID 175881426
2-[4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclohexyl]oxypyridine (PubChem CID 175881426) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-[4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclohexyl]oxypyridine.
| Compound Name | 2-[4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclohexyl]oxypyridine |
|---|---|
| PubChem CID | 175881426 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-[4-(5-methyl-1H-1,2,4-triazol-3-yl)cyclohexyl]oxypyridine |
| SMILES | Cc1nc(C2CCC(Oc3ccccn3)CC2)n[nH]1 |
| InChI | InChI=1S/C14H18N4O/c1-10-16-14(18-17-10)11-5-7-12(8-6-11)19-13-4-2-3-9-15-13/h2-4,9,11-12H,5-8H2,1H3,(H,16,17,18) |
| InChIKey | IKOLATYRDQIURU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |