About 3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone
3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone (PubChem CID 175882073) has the molecular formula C10H13N3OS
and a molecular weight of 223.30 g/mol. Its IUPAC name is 3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone.
Molecular Properties
| Compound Name | 3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone |
| PubChem CID | 175882073 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1nccs1)N1C2CCC1CNC2 |
| InChI | InChI=1S/C10H13N3OS/c14-10(9-12-3-4-15-9)13-7-1-2-8(13)6-11-5-7/h3-4,7-8,11H,1-2,5-6H2 |
| InChIKey | LSYURNSUEALWEP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone?
The IUPAC name of 3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone (CID 175882073) is 3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone.
What is the SMILES notation for 3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone?
The canonical SMILES for 3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone is O=C(c1nccs1)N1C2CCC1CNC2.
What is the InChIKey of 3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone?
The InChIKey is LSYURNSUEALWEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3OS/c14-10(9-12-3-4-15-9)13-7-1-2-8(13)6-11-5-7/h3-4,7-8,11H,1-2,5-6H2.
What are the key properties of 3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone?
3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone has a molecular weight of 223.30 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,8-diazabicyclo[3.2.1]octan-8-yl(1,3-thiazol-2-yl)methanone is sourced from PubChem (CID 175882073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).