C22H42O5Si — CID 175882106
2-[(2R,3S,4S,6R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetaldehyde (PubChem CID 175882106) has the molecular formula C22H42O5Si and a molecular weight of 414.66 g/mol. Its IUPAC name is 2-[(2R,3S,4S,6R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,3S,4S,6R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 175882106 |
| Molecular Formula | C22H42O5Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 2-[(2R,3S,4S,6R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methyl-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetaldehyde |
| SMILES | CC(C)[Si](O[C@H]1C[C@H]([C@@H]2COC(C)(C)O2)O[C@H](CC=O)[C@@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H42O5Si/c1-14(2)28(15(3)4,16(5)6)27-19-12-20(21-13-24-22(8,9)26-21)25-18(10-11-23)17(19)7/h11,14-21H,10,12-13H2,1-9H3/t17-,18+,19-,20+,21-/m0/s1 |
| InChIKey | DASMBGOKMXKTSE-LUYSREMJSA-N |
| XLogP | 5.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|